C22H26O2 — CID 59086439
(5R,9R)-16-methoxy-5-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-2,13(18),14,16-tetraen-8-one (PubChem CID 59086439) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (5R,9R)-16-methoxy-5-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-2,13(18),14,16-tetraen-8-one.
| Compound Name | (5R,9R)-16-methoxy-5-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-2,13(18),14,16-tetraen-8-one |
|---|---|
| PubChem CID | 59086439 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (5R,9R)-16-methoxy-5-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-2,13(18),14,16-tetraen-8-one |
| SMILES | COc1ccc2c(c1)CCC1C3=CC[C@@]4(C)CCC(=O)[C@@]34CCC21 |
| InChI | InChI=1S/C22H26O2/c1-21-10-8-19-18-5-3-14-13-15(24-2)4-6-16(14)17(18)7-12-22(19,21)20(23)9-11-21/h4,6,8,13,17-18H,3,5,7,9-12H2,1-2H3/t17?,18?,21-,22+/m0/s1 |
| InChIKey | XGJRXLFRDCIDAH-GHZCZGOHSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|