C23H30O3 — CID 10594293
(1R,2S,5S,6R,9S,12S)-5-hydroxy-16-methoxy-5,9-dimethylpentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-trien-8-one (PubChem CID 10594293) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (1R,2S,5S,6R,9S,12S)-5-hydroxy-16-methoxy-5,9-dimethylpentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-trien-8-one.
| Compound Name | (1R,2S,5S,6R,9S,12S)-5-hydroxy-16-methoxy-5,9-dimethylpentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-trien-8-one |
|---|---|
| PubChem CID | 10594293 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (1R,2S,5S,6R,9S,12S)-5-hydroxy-16-methoxy-5,9-dimethylpentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-trien-8-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C[C@@H]3[C@]12CC[C@]3(C)O |
| InChI | InChI=1S/C23H30O3/c1-21-9-8-17-16-6-5-15(26-3)12-14(16)4-7-18(17)23(21)11-10-22(2,25)19(23)13-20(21)24/h5-6,12,17-19,25H,4,7-11,13H2,1-3H3/t17-,18-,19+,21-,22+,23+/m1/s1 |
| InChIKey | AUBPICLEHBDCOJ-NJZIGWLISA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |