C24H30O2S2 — CID 10573854
(1'R,2'R,6'S,9'S,12'S)-16'-methoxy-9'-methylspiro[1,3-dithiolane-2,4'-pentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-triene]-8'-one (PubChem CID 10573854) has the molecular formula C24H30O2S2 and a molecular weight of 414.64 g/mol. Its IUPAC name is (1'R,2'R,6'S,9'S,12'S)-16'-methoxy-9'-methylspiro[1,3-dithiolane-2,4'-pentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-triene]-8'-one.
| Compound Name | (1'R,2'R,6'S,9'S,12'S)-16'-methoxy-9'-methylspiro[1,3-dithiolane-2,4'-pentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-triene]-8'-one |
|---|---|
| PubChem CID | 10573854 |
| Molecular Formula | C24H30O2S2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (1'R,2'R,6'S,9'S,12'S)-16'-methoxy-9'-methylspiro[1,3-dithiolane-2,4'-pentacyclo[10.8.0.02,6.02,9.013,18]icosa-13(18),14,16-triene]-8'-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C[C@H]3CC4(C[C@@]312)SCCS4 |
| InChI | InChI=1S/C24H30O2S2/c1-22-8-7-19-18-5-4-17(26-2)11-15(18)3-6-20(19)24(22)14-23(27-9-10-28-23)13-16(24)12-21(22)25/h4-5,11,16,19-20H,3,6-10,12-14H2,1-2H3/t16-,19+,20+,22+,24+/m0/s1 |
| InChIKey | ASTHNJJBLNZAAL-FRHCNZIGSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |