C19H21ClO2 — CID 11609389
(7S)-13-chloro-14-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trien-6-one (PubChem CID 11609389) has the molecular formula C19H21ClO2 and a molecular weight of 316.83 g/mol. Its IUPAC name is (7S)-13-chloro-14-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trien-6-one.
| Compound Name | (7S)-13-chloro-14-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trien-6-one |
|---|---|
| PubChem CID | 11609389 |
| Molecular Formula | C19H21ClO2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (7S)-13-chloro-14-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trien-6-one |
| SMILES | C[C@]12CCC3c4cc(Cl)c(O)cc4CCC3C13CC3CC2=O |
| InChI | InChI=1S/C19H21ClO2/c1-18-5-4-12-13-8-15(20)16(21)6-10(13)2-3-14(12)19(18)9-11(19)7-17(18)22/h6,8,11-12,14,21H,2-5,7,9H2,1H3/t11?,12?,14?,18-,19?/m1/s1 |
| InChIKey | RAMQRHOXZATOEL-IFWIUCFVSA-N |
| XLogP | 4.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |