C23H28O2 — CID 10806806
(1R,2R,7R,10S,13S)-17-methoxy-10-methylpentacyclo[11.8.0.02,7.02,10.014,19]henicosa-4,14(19),15,17-tetraen-9-one (PubChem CID 10806806) has the molecular formula C23H28O2 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1R,2R,7R,10S,13S)-17-methoxy-10-methylpentacyclo[11.8.0.02,7.02,10.014,19]henicosa-4,14(19),15,17-tetraen-9-one.
| Compound Name | (1R,2R,7R,10S,13S)-17-methoxy-10-methylpentacyclo[11.8.0.02,7.02,10.014,19]henicosa-4,14(19),15,17-tetraen-9-one |
|---|---|
| PubChem CID | 10806806 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (1R,2R,7R,10S,13S)-17-methoxy-10-methylpentacyclo[11.8.0.02,7.02,10.014,19]henicosa-4,14(19),15,17-tetraen-9-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C[C@H]3CC=CC[C@@]312 |
| InChI | InChI=1S/C23H28O2/c1-22-12-10-19-18-8-7-17(25-2)13-15(18)6-9-20(19)23(22)11-4-3-5-16(23)14-21(22)24/h3-4,7-8,13,16,19-20H,5-6,9-12,14H2,1-2H3/t16-,19-,20-,22-,23-/m1/s1 |
| InChIKey | ZBMLHIYKXDQXAW-NPNODJHLSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|