C27H31NO3 — CID 67638333
[(1R,2R,4R,6S,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl]-phenylcarbamic acid (PubChem CID 67638333) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(1R,2R,4R,6S,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl]-phenylcarbamic acid.
| Compound Name | [(1R,2R,4R,6S,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 67638333 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(1R,2R,4R,6S,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl]-phenylcarbamic acid |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](N(C(=O)O)c3ccccc3)C[C@H]3C[C@@]312 |
| InChI | InChI=1S/C27H31NO3/c1-26-13-12-22-21-10-9-20(31-2)14-17(21)8-11-23(22)27(26)16-18(27)15-24(26)28(25(29)30)19-6-4-3-5-7-19/h3-7,9-10,14,18,22-24H,8,11-13,15-16H2,1-2H3,(H,29,30)/t18-,22+,23+,24-,26+,27+/m0/s1 |
| InChIKey | QQCNKXKZKPUDDK-GTLSGEIOSA-N |
| XLogP | 6.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |