C29H30O2 — CID 177458018
1-[(1R,2R,11S,14S,15R)-7-methoxy-14-methyl-15-phenyl-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16,18-pentaenyl]ethanone (PubChem CID 177458018) has the molecular formula C29H30O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-[(1R,2R,11S,14S,15R)-7-methoxy-14-methyl-15-phenyl-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16,18-pentaenyl]ethanone.
| Compound Name | 1-[(1R,2R,11S,14S,15R)-7-methoxy-14-methyl-15-phenyl-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16,18-pentaenyl]ethanone |
|---|---|
| PubChem CID | 177458018 |
| Molecular Formula | C29H30O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[(1R,2R,11S,14S,15R)-7-methoxy-14-methyl-15-phenyl-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16,18-pentaenyl]ethanone |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@]13C=C[C@]2(c1ccccc1)C(C(C)=O)=C3 |
| InChI | InChI=1S/C29H30O2/c1-19(30)26-18-28-15-16-29(26,21-7-5-4-6-8-21)27(28,2)14-13-24-23-11-10-22(31-3)17-20(23)9-12-25(24)28/h4-8,10-11,15-18,24-25H,9,12-14H2,1-3H3/t24-,25-,27+,28+,29+/m1/s1 |
| InChIKey | ITPMXQOCEOACKU-RNYTVLMMSA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|