C29H32O5S — CID 15622826
[(1R,2R,11S,14S,15R,19R)-19-(benzenesulfonyl)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraenyl] acetate (PubChem CID 15622826) has the molecular formula C29H32O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is [(1R,2R,11S,14S,15R,19R)-19-(benzenesulfonyl)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraenyl] acetate.
| Compound Name | [(1R,2R,11S,14S,15R,19R)-19-(benzenesulfonyl)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraenyl] acetate |
|---|---|
| PubChem CID | 15622826 |
| Molecular Formula | C29H32O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | [(1R,2R,11S,14S,15R,19R)-19-(benzenesulfonyl)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraenyl] acetate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@]13C=C[C@]2(OC(C)=O)[C@H](S(=O)(=O)c1ccccc1)C3 |
| InChI | InChI=1S/C29H32O5S/c1-19(30)34-29-16-15-28(18-26(29)35(31,32)22-7-5-4-6-8-22)25-12-9-20-17-21(33-3)10-11-23(20)24(25)13-14-27(28,29)2/h4-8,10-11,15-17,24-26H,9,12-14,18H2,1-3H3/t24-,25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | PIYGGYGMVZBHBD-VUTJFYCQSA-N |
| XLogP | 5.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|