C26H34O4 — CID 18666207
[(2R,11S,14S,15S,16R)-7-methoxy-14-methyl-15-(2-methyl-1,3-dioxolan-2-yl)-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraenyl]methanol (PubChem CID 18666207) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(2R,11S,14S,15S,16R)-7-methoxy-14-methyl-15-(2-methyl-1,3-dioxolan-2-yl)-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraenyl]methanol.
| Compound Name | [(2R,11S,14S,15S,16R)-7-methoxy-14-methyl-15-(2-methyl-1,3-dioxolan-2-yl)-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraenyl]methanol |
|---|---|
| PubChem CID | 18666207 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(2R,11S,14S,15S,16R)-7-methoxy-14-methyl-15-(2-methyl-1,3-dioxolan-2-yl)-16-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraenyl]methanol |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)C13C=C[C@]2(C1(C)OCCO1)[C@H](CO)C3 |
| InChI | InChI=1S/C26H34O4/c1-23-9-8-21-20-6-5-19(28-3)14-17(20)4-7-22(21)25(23)10-11-26(23,18(15-25)16-27)24(2)29-12-13-30-24/h5-6,10-11,14,18,21-22,27H,4,7-9,12-13,15-16H2,1-3H3/t18-,21+,22+,23-,25?,26-/m0/s1 |
| InChIKey | RYYYDWWEWDDIAH-PTCREPNOSA-N |
| XLogP | 4.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|