C27H38O3 — CID 88645640
[(14S)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl] hexanoate (PubChem CID 88645640) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [(14S)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl] hexanoate.
| Compound Name | [(14S)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl] hexanoate |
|---|---|
| PubChem CID | 88645640 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [(14S)-7-methoxy-14-methyl-15-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl] hexanoate |
| SMILES | CCCCCC(=O)OC12CCC3(CC1)C1CCc4cc(OC)ccc4C1CC[C@]23C |
| InChI | InChI=1S/C27H38O3/c1-4-5-6-7-24(28)30-27-16-14-26(15-17-27)23-11-8-19-18-20(29-3)9-10-21(19)22(23)12-13-25(26,27)2/h9-10,18,22-23H,4-8,11-17H2,1-3H3/t22?,23?,25-,26?,27?/m0/s1 |
| InChIKey | FURJHSIDOGMJSK-XQKTTWCISA-N |
| XLogP | 6.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|