C25H30O4 — CID 70274231
methyl (2R,11S,14S,15S,16R)-15-acetyl-7-methoxy-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-16-carboxylate (PubChem CID 70274231) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is methyl (2R,11S,14S,15S,16R)-15-acetyl-7-methoxy-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-16-carboxylate.
| Compound Name | methyl (2R,11S,14S,15S,16R)-15-acetyl-7-methoxy-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 70274231 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | methyl (2R,11S,14S,15S,16R)-15-acetyl-7-methoxy-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-16-carboxylate |
| SMILES | COC(=O)[C@@H]1CC23C=C[C@@]1(C(C)=O)[C@@]2(C)CC[C@@H]1c2ccc(OC)cc2CC[C@H]13 |
| InChI | InChI=1S/C25H30O4/c1-15(26)25-12-11-24(14-21(25)22(27)29-4)20-8-5-16-13-17(28-3)6-7-18(16)19(20)9-10-23(24,25)2/h6-7,11-13,19-21H,5,8-10,14H2,1-4H3/t19-,20-,21+,23+,24?,25+/m1/s1 |
| InChIKey | UGOCKAJKDAEBIL-RSZWILRZSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|