C20H24O3 — CID 22862139
(1R,2R,11S,14S,15R,16R)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-7,15,16-triol (PubChem CID 22862139) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (1R,2R,11S,14S,15R,16R)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-7,15,16-triol.
| Compound Name | (1R,2R,11S,14S,15R,16R)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-7,15,16-triol |
|---|---|
| PubChem CID | 22862139 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (1R,2R,11S,14S,15R,16R)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,18-tetraene-7,15,16-triol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@]13C=C[C@]2(O)[C@H](O)C3 |
| InChI | InChI=1S/C20H24O3/c1-18-7-6-15-14-4-3-13(21)10-12(14)2-5-16(15)19(18)8-9-20(18,23)17(22)11-19/h3-4,8-10,15-17,21-23H,2,5-7,11H2,1H3/t15-,16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | NVXUOXPUYATDPX-MUJBESKKSA-N |
| XLogP | 2.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|