C21H26O2 — CID 10335581
(1R,2R,11S,14S,15R,16S)-14-methylpentacyclo[14.2.2.01,14.02,11.05,10]icosa-5(10),6,8,17-tetraene-7,15-diol (PubChem CID 10335581) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (1R,2R,11S,14S,15R,16S)-14-methylpentacyclo[14.2.2.01,14.02,11.05,10]icosa-5(10),6,8,17-tetraene-7,15-diol.
| Compound Name | (1R,2R,11S,14S,15R,16S)-14-methylpentacyclo[14.2.2.01,14.02,11.05,10]icosa-5(10),6,8,17-tetraene-7,15-diol |
|---|---|
| PubChem CID | 10335581 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (1R,2R,11S,14S,15R,16S)-14-methylpentacyclo[14.2.2.01,14.02,11.05,10]icosa-5(10),6,8,17-tetraene-7,15-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@]13C=C[C@H](CC3)[C@H]2O |
| InChI | InChI=1S/C21H26O2/c1-20-9-8-17-16-4-3-15(22)12-14(16)2-5-18(17)21(20)10-6-13(7-11-21)19(20)23/h3-4,6,10,12-13,17-19,22-23H,2,5,7-9,11H2,1H3/t13-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | TYRRGYCBIYKBPN-MFGAOICXSA-N |
| XLogP | 4.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|