C29H33NO2 — CID 70599100
[(1R,2R,4R,6S,7S,10S)-7-methyl-14-prop-1-enyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl] N-phenylcarbamate (PubChem CID 70599100) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is [(1R,2R,4R,6S,7S,10S)-7-methyl-14-prop-1-enyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl] N-phenylcarbamate.
| Compound Name | [(1R,2R,4R,6S,7S,10S)-7-methyl-14-prop-1-enyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 70599100 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | [(1R,2R,4R,6S,7S,10S)-7-methyl-14-prop-1-enyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11(16),12,14-trienyl] N-phenylcarbamate |
| SMILES | CC=Cc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(=O)Nc3ccccc3)C[C@H]3C[C@@]312 |
| InChI | InChI=1S/C29H33NO2/c1-3-7-19-10-12-23-20(16-19)11-13-25-24(23)14-15-28(2)26(17-21-18-29(21,25)28)32-27(31)30-22-8-5-4-6-9-22/h3-10,12,16,21,24-26H,11,13-15,17-18H2,1-2H3,(H,30,31)/t21-,24+,25+,26-,28+,29+/m0/s1 |
| InChIKey | IWLQNYFEMXUPSU-NMVUPLMLSA-N |
| XLogP | 7.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |