C22H29NO6S — CID 69378775
acetyl-[(1R,2S,4S,6S,7S,10S)-6-hydroxy-13-methoxy-7-methyl-14-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trienyl]sulfamic acid (PubChem CID 69378775) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is acetyl-[(1R,2S,4S,6S,7S,10S)-6-hydroxy-13-methoxy-7-methyl-14-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trienyl]sulfamic acid.
| Compound Name | acetyl-[(1R,2S,4S,6S,7S,10S)-6-hydroxy-13-methoxy-7-methyl-14-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trienyl]sulfamic acid |
|---|---|
| PubChem CID | 69378775 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | acetyl-[(1R,2S,4S,6S,7S,10S)-6-hydroxy-13-methoxy-7-methyl-14-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-trienyl]sulfamic acid |
| SMILES | COc1cc2c(cc1N(C(C)=O)S(=O)(=O)O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)C[C@@H]3C[C@]312 |
| InChI | InChI=1S/C22H29NO6S/c1-12(24)23(30(26,27)28)18-8-13-4-5-17-15(16(13)10-19(18)29-3)6-7-21(2)20(25)9-14-11-22(14,17)21/h8,10,14-15,17,20,25H,4-7,9,11H2,1-3H3,(H,26,27,28)/t14-,15-,17-,20+,21-,22+/m1/s1 |
| InChIKey | WTYDVTIBNQLDCM-CJUOQOSKSA-N |
| XLogP | 3.07 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|