C19H24 — CID 173440589
(1R,2R,4S,7S,10S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-triene (PubChem CID 173440589) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,2R,4S,7S,10S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-triene.
| Compound Name | (1R,2R,4S,7S,10S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-triene |
|---|---|
| PubChem CID | 173440589 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (1R,2R,4S,7S,10S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-11,13,15-triene |
| SMILES | C[C@@]12CC[C@H]3C[C@]31[C@@H]1CCc3ccccc3[C@H]1CC2 |
| InChI | InChI=1S/C19H24/c1-18-10-8-14-12-19(14,18)17-7-6-13-4-2-3-5-15(13)16(17)9-11-18/h2-5,14,16-17H,6-12H2,1H3/t14-,16+,17+,18-,19+/m0/s1 |
| InChIKey | TWOWAXCYSBXWBU-SXXASDTRSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |