C23H32O2Si — CID 68822952
[(1R,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-2,11(16),12,14-tetraenyl]oxy-trimethylsilane (PubChem CID 68822952) has the molecular formula C23H32O2Si and a molecular weight of 368.59 g/mol. Its IUPAC name is [(1R,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-2,11(16),12,14-tetraenyl]oxy-trimethylsilane.
| Compound Name | [(1R,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-2,11(16),12,14-tetraenyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 68822952 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [(1R,7S,10S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-2,11(16),12,14-tetraenyl]oxy-trimethylsilane |
| SMILES | COc1ccc2c(c1)CC[C@H]1C3=CC4CC4(O[Si](C)(C)C)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C23H32O2Si/c1-22-11-10-19-18-9-7-17(24-2)12-15(18)6-8-20(19)21(22)13-16-14-23(16,22)25-26(3,4)5/h7,9,12-13,16,19-20H,6,8,10-11,14H2,1-5H3/t16?,19-,20-,22+,23?/m1/s1 |
| InChIKey | SMQKSLBBTUGJAC-YTWOBLTESA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|