C24H35NO4Si — CID 20845845
[(8R,9S,13R,14R,17E)-17-methoxyimino-13-methyl-14-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 20845845) has the molecular formula C24H35NO4Si and a molecular weight of 429.63 g/mol. Its IUPAC name is [(8R,9S,13R,14R,17E)-17-methoxyimino-13-methyl-14-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,13R,14R,17E)-17-methoxyimino-13-methyl-14-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 20845845 |
| Molecular Formula | C24H35NO4Si |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [(8R,9S,13R,14R,17E)-17-methoxyimino-13-methyl-14-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CO/N=C1\CC[C@@]2(O[Si](C)(C)C)[C@@H]3CCc4cc(OC(C)=O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H35NO4Si/c1-16(26)28-18-8-9-19-17(15-18)7-10-21-20(19)11-13-23(2)22(25-27-3)12-14-24(21,23)29-30(4,5)6/h8-9,15,20-21H,7,10-14H2,1-6H3/b25-22+/t20-,21-,23-,24-/m1/s1 |
| InChIKey | LEDLOBXETAOOPL-KAYMEBBBSA-N |
| XLogP | 5.44 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|