C22H33NO3Si — CID 101280450
(8R,9S,13R,14R,17Z)-17-methoxyimino-13-methyl-3-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 101280450) has the molecular formula C22H33NO3Si and a molecular weight of 387.60 g/mol. Its IUPAC name is (8R,9S,13R,14R,17Z)-17-methoxyimino-13-methyl-3-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9S,13R,14R,17Z)-17-methoxyimino-13-methyl-3-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 101280450 |
| Molecular Formula | C22H33NO3Si |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (8R,9S,13R,14R,17Z)-17-methoxyimino-13-methyl-3-trimethylsilyloxy-6,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | CO/N=C1/CC[C@@]2(O)[C@@H]3CCc4cc(O[Si](C)(C)C)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H33NO3Si/c1-21-12-10-18-17-8-7-16(26-27(3,4)5)14-15(17)6-9-19(18)22(21,24)13-11-20(21)23-25-2/h7-8,14,18-19,24H,6,9-13H2,1-5H3/b23-20-/t18-,19-,21-,22-/m1/s1 |
| InChIKey | CJUCWDRCQRKKGS-DRLZNXDBSA-N |
| XLogP | 4.87 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|