C23H35NO2Si — CID 20845867
(E,8R,9S,13S,14S)-N-methoxy-1,13-dimethyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine (PubChem CID 20845867) has the molecular formula C23H35NO2Si and a molecular weight of 385.62 g/mol. Its IUPAC name is (E,8R,9S,13S,14S)-N-methoxy-1,13-dimethyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine.
| Compound Name | (E,8R,9S,13S,14S)-N-methoxy-1,13-dimethyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 20845867 |
| Molecular Formula | C23H35NO2Si |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (E,8R,9S,13S,14S)-N-methoxy-1,13-dimethyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine |
| SMILES | CO/N=C1\CC[C@H]2[C@@H]3CCc4cc(O[Si](C)(C)C)cc(C)c4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H35NO2Si/c1-15-13-17(26-27(4,5)6)14-16-7-8-18-19(22(15)16)11-12-23(2)20(18)9-10-21(23)24-25-3/h13-14,18-20H,7-12H2,1-6H3/b24-21+/t18-,19+,20+,23+/m1/s1 |
| InChIKey | VXQDFDJIOKROSU-LERPOLSZSA-N |
| XLogP | 6.07 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|