C25H41NO3Si2 — CID 101280452
(Z,7R,8R,9S,13S,14S)-N-methoxy-13-methyl-3,7-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine (PubChem CID 101280452) has the molecular formula C25H41NO3Si2 and a molecular weight of 459.78 g/mol. Its IUPAC name is (Z,7R,8R,9S,13S,14S)-N-methoxy-13-methyl-3,7-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine.
| Compound Name | (Z,7R,8R,9S,13S,14S)-N-methoxy-13-methyl-3,7-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 101280452 |
| Molecular Formula | C25H41NO3Si2 |
| Molecular Weight | 459.78 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (Z,7R,8R,9S,13S,14S)-N-methoxy-13-methyl-3,7-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine |
| SMILES | CO/N=C1/CC[C@H]2[C@H]3[C@H](CC[C@]12C)c1ccc(O[Si](C)(C)C)cc1C[C@H]3O[Si](C)(C)C |
| InChI | InChI=1S/C25H41NO3Si2/c1-25-14-13-20-19-10-9-18(28-30(3,4)5)15-17(19)16-22(29-31(6,7)8)24(20)21(25)11-12-23(25)26-27-2/h9-10,15,20-22,24H,11-14,16H2,1-8H3/b26-23-/t20-,21+,22-,24-,25+/m1/s1 |
| InChIKey | GNBGDFGBGJLMBN-ORSFKGSISA-N |
| XLogP | 6.59 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.78 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|