C27H42O3Si — CID 159055197
(4S,6S,8S,9S)-20-ethyl-16-methoxy-9-methyl-8-trimethylsilyloxypentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-6-ol (PubChem CID 159055197) has the molecular formula C27H42O3Si and a molecular weight of 442.72 g/mol. Its IUPAC name is (4S,6S,8S,9S)-20-ethyl-16-methoxy-9-methyl-8-trimethylsilyloxypentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-6-ol.
| Compound Name | (4S,6S,8S,9S)-20-ethyl-16-methoxy-9-methyl-8-trimethylsilyloxypentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-6-ol |
|---|---|
| PubChem CID | 159055197 |
| Molecular Formula | C27H42O3Si |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (4S,6S,8S,9S)-20-ethyl-16-methoxy-9-methyl-8-trimethylsilyloxypentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-6-ol |
| SMILES | CCC1Cc2cc(OC)ccc2C2CC[C@@]3(C)C(C[C@H]4C[C@H](O)C[C@]43O[Si](C)(C)C)C12 |
| InChI | InChI=1S/C27H42O3Si/c1-7-17-12-18-13-21(29-3)8-9-22(18)23-10-11-26(2)24(25(17)23)15-19-14-20(28)16-27(19,26)30-31(4,5)6/h8-9,13,17,19-20,23-25,28H,7,10-12,14-16H2,1-6H3/t17?,19-,20+,23?,24?,25?,26+,27+/m1/s1 |
| InChIKey | ZSPIZXDCKPKIMW-XZHMUIMSSA-N |
| XLogP | 6.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|