C23H32O3 — CID 67914488
(1R,2S,4S,7S,10S)-14-methoxy-6-(1-methoxyethoxy)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),12,14-triene (PubChem CID 67914488) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (1R,2S,4S,7S,10S)-14-methoxy-6-(1-methoxyethoxy)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),12,14-triene.
| Compound Name | (1R,2S,4S,7S,10S)-14-methoxy-6-(1-methoxyethoxy)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),12,14-triene |
|---|---|
| PubChem CID | 67914488 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (1R,2S,4S,7S,10S)-14-methoxy-6-(1-methoxyethoxy)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),12,14-triene |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC1CC12OC(C)OC |
| InChI | InChI=1S/C23H32O3/c1-14(24-3)26-23-13-16(23)12-21-20-7-5-15-11-17(25-4)6-8-18(15)19(20)9-10-22(21,23)2/h6,8,11,14,16,19-21H,5,7,9-10,12-13H2,1-4H3/t14?,16?,19-,20-,21+,22+,23?/m1/s1 |
| InChIKey | LSROJSLSLHBEOW-RANKBWFESA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|