C24H32O3 — CID 159055191
(4S,6S,8S,9S,10S)-21-ethyl-17-methoxy-10-methyl-7-oxahexacyclo[11.8.0.02,10.04,9.06,8.014,19]henicosa-14(19),15,17-trien-9-ol (PubChem CID 159055191) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (4S,6S,8S,9S,10S)-21-ethyl-17-methoxy-10-methyl-7-oxahexacyclo[11.8.0.02,10.04,9.06,8.014,19]henicosa-14(19),15,17-trien-9-ol.
| Compound Name | (4S,6S,8S,9S,10S)-21-ethyl-17-methoxy-10-methyl-7-oxahexacyclo[11.8.0.02,10.04,9.06,8.014,19]henicosa-14(19),15,17-trien-9-ol |
|---|---|
| PubChem CID | 159055191 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (4S,6S,8S,9S,10S)-21-ethyl-17-methoxy-10-methyl-7-oxahexacyclo[11.8.0.02,10.04,9.06,8.014,19]henicosa-14(19),15,17-trien-9-ol |
| SMILES | CCC1Cc2cc(OC)ccc2C2CC[C@@]3(C)C(C[C@H]4C[C@@H]5O[C@@H]5[C@]43O)C12 |
| InChI | InChI=1S/C24H32O3/c1-4-13-9-14-10-16(26-3)5-6-17(14)18-7-8-23(2)19(21(13)18)11-15-12-20-22(27-20)24(15,23)25/h5-6,10,13,15,18-22,25H,4,7-9,11-12H2,1-3H3/t13?,15-,18?,19?,20-,21?,22-,23-,24+/m0/s1 |
| InChIKey | SGQGQFKKSIRYHD-XNUHJMOESA-N |
| XLogP | 4.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|