C26H36O2 — CID 59631012
(4bS,6aS,6bS,10aR,11aS,11bR,12R)-6a-methyl-8-methylidene-12-propyl-4b,5,6,7,9,10,10a,11,11a,11b,12,13-dodecahydroindeno[2,1-a]phenanthrene-2,6b-diol (PubChem CID 59631012) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is (4bS,6aS,6bS,10aR,11aS,11bR,12R)-6a-methyl-8-methylidene-12-propyl-4b,5,6,7,9,10,10a,11,11a,11b,12,13-dodecahydroindeno[2,1-a]phenanthrene-2,6b-diol.
| Compound Name | (4bS,6aS,6bS,10aR,11aS,11bR,12R)-6a-methyl-8-methylidene-12-propyl-4b,5,6,7,9,10,10a,11,11a,11b,12,13-dodecahydroindeno[2,1-a]phenanthrene-2,6b-diol |
|---|---|
| PubChem CID | 59631012 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (4bS,6aS,6bS,10aR,11aS,11bR,12R)-6a-methyl-8-methylidene-12-propyl-4b,5,6,7,9,10,10a,11,11a,11b,12,13-dodecahydroindeno[2,1-a]phenanthrene-2,6b-diol |
| SMILES | C=C1CC[C@@H]2C[C@H]3[C@@H]4[C@H](CCC)Cc5cc(O)ccc5[C@H]4CC[C@]3(C)[C@]2(O)C1 |
| InChI | InChI=1S/C26H36O2/c1-4-5-17-12-18-13-20(27)8-9-21(18)22-10-11-25(3)23(24(17)22)14-19-7-6-16(2)15-26(19,25)28/h8-9,13,17,19,22-24,27-28H,2,4-7,10-12,14-15H2,1,3H3/t17-,19-,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | AELHIIWLJXIUKT-VMGWPWJLSA-N |
| XLogP | 5.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|