C24H32O2 — CID 58430146
(4R,8R,9S,20R)-20-ethyl-16-(hydroxymethyl)-9-methylpentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,13(18),14,16-tetraen-8-ol (PubChem CID 58430146) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (4R,8R,9S,20R)-20-ethyl-16-(hydroxymethyl)-9-methylpentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,13(18),14,16-tetraen-8-ol.
| Compound Name | (4R,8R,9S,20R)-20-ethyl-16-(hydroxymethyl)-9-methylpentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,13(18),14,16-tetraen-8-ol |
|---|---|
| PubChem CID | 58430146 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (4R,8R,9S,20R)-20-ethyl-16-(hydroxymethyl)-9-methylpentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,13(18),14,16-tetraen-8-ol |
| SMILES | CCC1Cc2cc(CO)ccc2C2CC[C@@]3(C)C(C[C@H]4CC=C[C@]43O)C12 |
| InChI | InChI=1S/C24H32O2/c1-3-16-12-17-11-15(14-25)6-7-19(17)20-8-10-23(2)21(22(16)20)13-18-5-4-9-24(18,23)26/h4,6-7,9,11,16,18,20-22,25-26H,3,5,8,10,12-14H2,1-2H3/t16?,18-,20?,21?,22?,23+,24+/m1/s1 |
| InChIKey | WBGIXRJYHVCFGL-JOXLLEGVSA-N |
| XLogP | 4.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|