C32H42O3 — CID 158058653
(6aS,6bS,8S,10aR)-6a-methyl-2-phenylmethoxy-12-propyl-5,6,7,8,9,10,10a,11,11a,11b,12,13-dodecahydro-4bH-indeno[2,1-a]phenanthrene-6b,8-diol (PubChem CID 158058653) has the molecular formula C32H42O3 and a molecular weight of 474.69 g/mol. Its IUPAC name is (6aS,6bS,8S,10aR)-6a-methyl-2-phenylmethoxy-12-propyl-5,6,7,8,9,10,10a,11,11a,11b,12,13-dodecahydro-4bH-indeno[2,1-a]phenanthrene-6b,8-diol.
| Compound Name | (6aS,6bS,8S,10aR)-6a-methyl-2-phenylmethoxy-12-propyl-5,6,7,8,9,10,10a,11,11a,11b,12,13-dodecahydro-4bH-indeno[2,1-a]phenanthrene-6b,8-diol |
|---|---|
| PubChem CID | 158058653 |
| Molecular Formula | C32H42O3 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | (6aS,6bS,8S,10aR)-6a-methyl-2-phenylmethoxy-12-propyl-5,6,7,8,9,10,10a,11,11a,11b,12,13-dodecahydro-4bH-indeno[2,1-a]phenanthrene-6b,8-diol |
| SMILES | CCCC1Cc2cc(OCc3ccccc3)ccc2C2CC[C@@]3(C)C(C[C@H]4CC[C@H](O)C[C@]43O)C12 |
| InChI | InChI=1S/C32H42O3/c1-3-7-22-16-23-17-26(35-20-21-8-5-4-6-9-21)12-13-27(23)28-14-15-31(2)29(30(22)28)18-24-10-11-25(33)19-32(24,31)34/h4-6,8-9,12-13,17,22,24-25,28-30,33-34H,3,7,10-11,14-16,18-20H2,1-2H3/t22?,24-,25+,28?,29?,30?,31+,32+/m1/s1 |
| InChIKey | GPVURJMGRPDYKQ-HGORSDBPSA-N |
| XLogP | 6.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |