C28H44N2O2 — CID 57278660
4-[(7R,8R,9S,13S,14S,16R)-17-(dimethylhydrazinylidene)-3-methoxy-13-methyl-7-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]butan-1-ol (PubChem CID 57278660) has the molecular formula C28H44N2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is 4-[(7R,8R,9S,13S,14S,16R)-17-(dimethylhydrazinylidene)-3-methoxy-13-methyl-7-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]butan-1-ol.
| Compound Name | 4-[(7R,8R,9S,13S,14S,16R)-17-(dimethylhydrazinylidene)-3-methoxy-13-methyl-7-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]butan-1-ol |
|---|---|
| PubChem CID | 57278660 |
| Molecular Formula | C28H44N2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 4-[(7R,8R,9S,13S,14S,16R)-17-(dimethylhydrazinylidene)-3-methoxy-13-methyl-7-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]butan-1-ol |
| SMILES | CCC[C@@H]1Cc2cc(OC)ccc2[C@H]2CC[C@]3(C)C(=NN(C)C)[C@H](CCCCO)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C28H44N2O2/c1-6-9-19-16-21-17-22(32-5)11-12-23(21)24-13-14-28(2)25(26(19)24)18-20(10-7-8-15-31)27(28)29-30(3)4/h11-12,17,19-20,24-26,31H,6-10,13-16,18H2,1-5H3/t19-,20-,24-,25+,26-,28+/m1/s1 |
| InChIKey | ARISPWYAPDDRQJ-ZQJBABNQSA-N |
| XLogP | 5.88 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|