C18H23NO2 — CID 10446656
(1S,11S,15R)-5-methoxy-15-methyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one (PubChem CID 10446656) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1S,11S,15R)-5-methoxy-15-methyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one.
| Compound Name | (1S,11S,15R)-5-methoxy-15-methyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one |
|---|---|
| PubChem CID | 10446656 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1S,11S,15R)-5-methoxy-15-methyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one |
| SMILES | COc1ccc2c(c1)CCN1[C@H]3CCC(=O)[C@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C18H23NO2/c1-18-9-7-15-14-4-3-13(21-2)11-12(14)8-10-19(15)16(18)5-6-17(18)20/h3-4,11,15-16H,5-10H2,1-2H3/t15-,16-,18+/m0/s1 |
| InChIKey | DBNZEKOOGJFTSI-XYJFISCASA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |