C19H25NO2 — CID 97356876
(1R,11R,15S)-5-hydroxy-15-propyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one (PubChem CID 97356876) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,11R,15S)-5-hydroxy-15-propyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one.
| Compound Name | (1R,11R,15S)-5-hydroxy-15-propyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one |
|---|---|
| PubChem CID | 97356876 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,11R,15S)-5-hydroxy-15-propyl-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-one |
| SMILES | CCC[C@]12CC[C@@H]3c4ccc(O)cc4CCN3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H25NO2/c1-2-9-19-10-7-16-15-4-3-14(21)12-13(15)8-11-20(16)17(19)5-6-18(19)22/h3-4,12,16-17,21H,2,5-11H2,1H3/t16-,17-,19+/m1/s1 |
| InChIKey | KKAVQDMECOIUDA-LMMKCTJWSA-N |
| XLogP | 3.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |