C13H17NO — CID 129390892
(1S)-1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-5-ol (PubChem CID 129390892) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (1S)-1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-5-ol.
| Compound Name | (1S)-1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 129390892 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (1S)-1-pyrrolidin-1-yl-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C13H17NO/c15-11-4-5-12-10(9-11)3-6-13(12)14-7-1-2-8-14/h4-5,9,13,15H,1-3,6-8H2/t13-/m0/s1 |
| InChIKey | OXTSVJYIEFTUFI-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |