C14H19NO — CID 129389365
(1S)-1-piperidin-1-yl-2,3-dihydro-1H-inden-5-ol (PubChem CID 129389365) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (1S)-1-piperidin-1-yl-2,3-dihydro-1H-inden-5-ol.
| Compound Name | (1S)-1-piperidin-1-yl-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 129389365 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1S)-1-piperidin-1-yl-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CC[C@@H]2N1CCCCC1 |
| InChI | InChI=1S/C14H19NO/c16-12-5-6-13-11(10-12)4-7-14(13)15-8-2-1-3-9-15/h5-6,10,14,16H,1-4,7-9H2/t14-/m0/s1 |
| InChIKey | MBYSPXSEXYPXKI-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |