C15H19LiO2 — CID 134982320
lithium (3S,3aR,9bR)-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-olate (PubChem CID 134982320) has the molecular formula C15H19LiO2 and a molecular weight of 238.26 g/mol. Its IUPAC name is lithium (3S,3aR,9bR)-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-olate.
| Compound Name | lithium (3S,3aR,9bR)-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-olate |
|---|---|
| PubChem CID | 134982320 |
| Molecular Formula | C15H19LiO2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | lithium (3S,3aR,9bR)-7-methoxy-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-olate |
| SMILES | COc1ccc2c(c1)CC[C@]1(C)[C@@H]2CC[C@@H]1[O-].[Li+] |
| InChI | InChI=1S/C15H19O2.Li/c1-15-8-7-10-9-11(17-2)3-4-12(10)13(15)5-6-14(15)16;/h3-4,9,13-14H,5-8H2,1-2H3;/q-1;+1/t13-,14+,15-;/m1./s1 |
| InChIKey | BENVNRMVXGRSHS-USAYTKQKSA-N |
| XLogP | -0.74 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |