C20H24O — CID 95564593
(13R,14R,17S)-3-methoxy-13,17-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene (PubChem CID 95564593) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is (13R,14R,17S)-3-methoxy-13,17-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene.
| Compound Name | (13R,14R,17S)-3-methoxy-13,17-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 95564593 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (13R,14R,17S)-3-methoxy-13,17-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene |
| SMILES | COc1ccc2c3c(ccc2c1)[C@@H]1CC[C@H](C)[C@@]1(C)CC3 |
| InChI | InChI=1S/C20H24O/c1-13-4-9-19-18-7-5-14-12-15(21-3)6-8-16(14)17(18)10-11-20(13,19)2/h5-8,12-13,19H,4,9-11H2,1-3H3/t13-,19-,20+/m0/s1 |
| InChIKey | CZFSAKQUVJCCQO-QTJFZDIUSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |