C22H26O3 — CID 11439167
[(13S,14S,17S)-3-methoxy-2,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 11439167) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(13S,14S,17S)-3-methoxy-2,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(13S,14S,17S)-3-methoxy-2,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 11439167 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [(13S,14S,17S)-3-methoxy-2,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COc1cc2ccc3c(c2cc1C)CC[C@]1(C)[C@@H](OC(C)=O)CC[C@@H]31 |
| InChI | InChI=1S/C22H26O3/c1-13-11-18-15(12-20(13)24-4)5-6-17-16(18)9-10-22(3)19(17)7-8-21(22)25-14(2)23/h5-6,11-12,19,21H,7-10H2,1-4H3/t19-,21-,22-/m0/s1 |
| InChIKey | MAVZSRFJARZLTM-BVSLBCMMSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |