C21H30O3 — CID 10592553
[(2R,3S,8R)-14-methoxy-7,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trienyl] acetate (PubChem CID 10592553) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(2R,3S,8R)-14-methoxy-7,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trienyl] acetate.
| Compound Name | [(2R,3S,8R)-14-methoxy-7,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trienyl] acetate |
|---|---|
| PubChem CID | 10592553 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(2R,3S,8R)-14-methoxy-7,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trienyl] acetate |
| SMILES | COc1cc2c(cc1C)CC[C@@H]1[C@H](CCCC1(C)C)[C@H]2OC(C)=O |
| InChI | InChI=1S/C21H30O3/c1-13-11-15-8-9-18-16(7-6-10-21(18,3)4)20(24-14(2)22)17(15)12-19(13)23-5/h11-12,16,18,20H,6-10H2,1-5H3/t16-,18+,20+/m0/s1 |
| InChIKey | SIWOAKVCBQNIKV-ILZDJORESA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |