C20H26O4 — CID 101447051
methyl (4bS,8aR)-3-acetyloxy-8,8-dimethyl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-2-carboxylate (PubChem CID 101447051) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is methyl (4bS,8aR)-3-acetyloxy-8,8-dimethyl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-2-carboxylate.
| Compound Name | methyl (4bS,8aR)-3-acetyloxy-8,8-dimethyl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 101447051 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | methyl (4bS,8aR)-3-acetyloxy-8,8-dimethyl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1OC(C)=O)[C@H]1CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C20H26O4/c1-12(21)24-18-11-15-13(10-16(18)19(22)23-4)7-8-17-14(15)6-5-9-20(17,2)3/h10-11,14,17H,5-9H2,1-4H3/t14-,17-/m1/s1 |
| InChIKey | OSZOLLKQBOIYEM-RHSMWYFYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|