C17H18F4O5 — CID 143789209
methyl 5-(2,2-dimethylcyclopentyl)-2-fluoro-4-(trifluoromethoxycarbonyloxy)benzoate (PubChem CID 143789209) has the molecular formula C17H18F4O5 and a molecular weight of 378.32 g/mol. Its IUPAC name is methyl 5-(2,2-dimethylcyclopentyl)-2-fluoro-4-(trifluoromethoxycarbonyloxy)benzoate.
| Compound Name | methyl 5-(2,2-dimethylcyclopentyl)-2-fluoro-4-(trifluoromethoxycarbonyloxy)benzoate |
|---|---|
| PubChem CID | 143789209 |
| Molecular Formula | C17H18F4O5 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 5-(2,2-dimethylcyclopentyl)-2-fluoro-4-(trifluoromethoxycarbonyloxy)benzoate |
| SMILES | COC(=O)c1cc(C2CCCC2(C)C)c(OC(=O)OC(F)(F)F)cc1F |
| InChI | InChI=1S/C17H18F4O5/c1-16(2)6-4-5-11(16)9-7-10(14(22)24-3)12(18)8-13(9)25-15(23)26-17(19,20)21/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | ZPALZHFTEVVPFB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|