C16H19F3O5S — CID 87398209
methyl 3-[(1S)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 87398209) has the molecular formula C16H19F3O5S and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl 3-[(1S)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 3-[(1S)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 87398209 |
| Molecular Formula | C16H19F3O5S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | methyl 3-[(1S)-2,2-dimethylcyclopentyl]-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c([C@H]2CCCC2(C)C)c1 |
| InChI | InChI=1S/C16H19F3O5S/c1-15(2)8-4-5-12(15)11-9-10(14(20)23-3)6-7-13(11)24-25(21,22)16(17,18)19/h6-7,9,12H,4-5,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | BOVLRBURYLYYIF-GFCCVEGCSA-N |
| XLogP | 4.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|