C22H27F3O5S — CID 163262972
methyl 6-(3,3-dimethylcyclohexyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 163262972) has the molecular formula C22H27F3O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is methyl 6-(3,3-dimethylcyclohexyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 6-(3,3-dimethylcyclohexyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 163262972 |
| Molecular Formula | C22H27F3O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | methyl 6-(3,3-dimethylcyclohexyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCCC(C1CCCC(C)(C)C1)=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H27F3O5S/c1-21(2)11-5-7-16(13-21)17-8-4-6-14-12-15(20(26)29-3)9-10-18(14)19(17)30-31(27,28)22(23,24)25/h9-10,12,16H,4-8,11,13H2,1-3H3 |
| InChIKey | DCVKBMMRBMZJGY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|