C20H15F5O5S — CID 163262347
methyl 6-(2,4-difluorophenyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 163262347) has the molecular formula C20H15F5O5S and a molecular weight of 462.39 g/mol. Its IUPAC name is methyl 6-(2,4-difluorophenyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 6-(2,4-difluorophenyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 163262347 |
| Molecular Formula | C20H15F5O5S |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | methyl 6-(2,4-difluorophenyl)-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCCC(c1ccc(F)cc1F)=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H15F5O5S/c1-29-19(26)12-5-7-14-11(9-12)3-2-4-16(15-8-6-13(21)10-17(15)22)18(14)30-31(27,28)20(23,24)25/h5-10H,2-4H2,1H3 |
| InChIKey | OFIBWGPTGRBCKQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|