C20H16F3NO4S — CID 177232604
[6-(2-cyanophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate (PubChem CID 177232604) has the molecular formula C20H16F3NO4S and a molecular weight of 423.41 g/mol. Its IUPAC name is [6-(2-cyanophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate.
| Compound Name | [6-(2-cyanophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 177232604 |
| Molecular Formula | C20H16F3NO4S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [6-(2-cyanophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)CCCC(c1ccccc1C#N)=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO4S/c1-27-15-9-10-17-13(11-15)6-4-8-18(16-7-3-2-5-14(16)12-24)19(17)28-29(25,26)20(21,22)23/h2-3,5,7,9-11H,4,6,8H2,1H3 |
| InChIKey | GVUNIWOTMWHQCH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|