C19H15ClF4O4S — CID 134521212
[6-(4-chloro-3-fluorophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate (PubChem CID 134521212) has the molecular formula C19H15ClF4O4S and a molecular weight of 450.84 g/mol. Its IUPAC name is [6-(4-chloro-3-fluorophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate.
| Compound Name | [6-(4-chloro-3-fluorophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134521212 |
| Molecular Formula | C19H15ClF4O4S |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | [6-(4-chloro-3-fluorophenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)CCCC(c1ccc(Cl)c(F)c1)=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H15ClF4O4S/c1-27-13-6-7-15-11(9-13)3-2-4-14(12-5-8-16(20)17(21)10-12)18(15)28-29(25,26)19(22,23)24/h5-10H,2-4H2,1H3 |
| InChIKey | OKYBXTFYEKRNDL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|