C21H18F6O5S — CID 123535853
[3-fluoro-6-(4-fluoro-3-methoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] 1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 123535853) has the molecular formula C21H18F6O5S and a molecular weight of 496.43 g/mol. Its IUPAC name is [3-fluoro-6-(4-fluoro-3-methoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [3-fluoro-6-(4-fluoro-3-methoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 123535853 |
| Molecular Formula | C21H18F6O5S |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | [3-fluoro-6-(4-fluoro-3-methoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl] 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | COc1cc(C2=C(OS(=O)(=O)C(F)(F)C(F)F)c3cc(F)c(OC)cc3CCC2)ccc1F |
| InChI | InChI=1S/C21H18F6O5S/c1-30-17-9-12(6-7-15(17)22)13-5-3-4-11-8-18(31-2)16(23)10-14(11)19(13)32-33(28,29)21(26,27)20(24)25/h6-10,20H,3-5H2,1-2H3 |
| InChIKey | CRZFDHCISHWXEX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|