C20H21F3O5S — CID 177232721
methyl 6-[(3E)-2-methylpenta-1,3-dien-3-yl]-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 177232721) has the molecular formula C20H21F3O5S and a molecular weight of 430.44 g/mol. Its IUPAC name is methyl 6-[(3E)-2-methylpenta-1,3-dien-3-yl]-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 6-[(3E)-2-methylpenta-1,3-dien-3-yl]-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 177232721 |
| Molecular Formula | C20H21F3O5S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | methyl 6-[(3E)-2-methylpenta-1,3-dien-3-yl]-5-(trifluoromethylsulfonyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | C=C(C)/C(=C\C)C1=C(OS(=O)(=O)C(F)(F)F)c2ccc(C(=O)OC)cc2CCC1 |
| InChI | InChI=1S/C20H21F3O5S/c1-5-15(12(2)3)17-8-6-7-13-11-14(19(24)27-4)9-10-16(13)18(17)28-29(25,26)20(21,22)23/h5,9-11H,2,6-8H2,1,3-4H3/b15-5+ |
| InChIKey | QUSDVGKRQIKAMG-PJQLUOCWSA-N |
| XLogP | 4.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|