C24H28O5 — CID 11749824
[(13S,14S,17S)-6-hydroxy-13-methyl-3-propanoyloxy-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 11749824) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is [(13S,14S,17S)-6-hydroxy-13-methyl-3-propanoyloxy-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(13S,14S,17S)-6-hydroxy-13-methyl-3-propanoyloxy-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 11749824 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [(13S,14S,17S)-6-hydroxy-13-methyl-3-propanoyloxy-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc2c3c(cc(O)c2c1)[C@@H]1CC[C@H](OC(=O)CC)[C@@]1(C)CC3 |
| InChI | InChI=1S/C24H28O5/c1-4-22(26)28-14-6-7-15-16-10-11-24(3)19(8-9-21(24)29-23(27)5-2)17(16)13-20(25)18(15)12-14/h6-7,12-13,19,21,25H,4-5,8-11H2,1-3H3/t19-,21-,24-/m0/s1 |
| InChIKey | WVSZLTMWHPJYBJ-PTLVVNQVSA-N |
| XLogP | 5.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|