C18H20O6S — CID 54575173
(6,17-dihydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl) hydrogen sulfate (PubChem CID 54575173) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is (6,17-dihydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl) hydrogen sulfate.
| Compound Name | (6,17-dihydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 54575173 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (6,17-dihydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl) hydrogen sulfate |
| SMILES | CC12CCc3c(cc(O)c4cc(OS(=O)(=O)O)ccc34)C1CCC2O |
| InChI | InChI=1S/C18H20O6S/c1-18-7-6-12-11-3-2-10(24-25(21,22)23)8-14(11)16(19)9-13(12)15(18)4-5-17(18)20/h2-3,8-9,15,17,19-20H,4-7H2,1H3,(H,21,22,23) |
| InChIKey | YLHVTTFVVCVPCT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|