C21H22N4O2 — CID 101282063
(3S,3aS,9bS)-3a-methyl-7-(1-phenyltetrazol-5-yl)oxy-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-ol (PubChem CID 101282063) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3S,3aS,9bS)-3a-methyl-7-(1-phenyltetrazol-5-yl)oxy-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-ol.
| Compound Name | (3S,3aS,9bS)-3a-methyl-7-(1-phenyltetrazol-5-yl)oxy-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-ol |
|---|---|
| PubChem CID | 101282063 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3S,3aS,9bS)-3a-methyl-7-(1-phenyltetrazol-5-yl)oxy-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalen-3-ol |
| SMILES | C[C@]12CCc3cc(Oc4nnnn4-c4ccccc4)ccc3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C21H22N4O2/c1-21-12-11-14-13-16(7-8-17(14)18(21)9-10-19(21)26)27-20-22-23-24-25(20)15-5-3-2-4-6-15/h2-8,13,18-19,26H,9-12H2,1H3/t18-,19-,21-/m0/s1 |
| InChIKey | GADNMBSLPDFNOK-ZJOUEHCJSA-N |
| XLogP | 3.65 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |