C24H28O4 — CID 40654525
[(13S,14S,17S)-3-acetyloxy-13-ethyl-4-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 40654525) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(13S,14S,17S)-3-acetyloxy-13-ethyl-4-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(13S,14S,17S)-3-acetyloxy-13-ethyl-4-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 40654525 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(13S,14S,17S)-3-acetyloxy-13-ethyl-4-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC[C@]12CCc3c(ccc4c(C)c(OC(C)=O)ccc34)[C@@H]1CC[C@@H]2OC(C)=O |
| InChI | InChI=1S/C24H28O4/c1-5-24-13-12-19-18-8-10-22(27-15(3)25)14(2)17(18)6-7-20(19)21(24)9-11-23(24)28-16(4)26/h6-8,10,21,23H,5,9,11-13H2,1-4H3/t21-,23-,24-/m0/s1 |
| InChIKey | ZNHWDMDURSRFGN-XWGVYQGASA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|