C23H24O4 — CID 58636069
(4'-acetyloxy-7,7'-dimethyl-3,3'-spirobi[1,2-dihydroindene]-4-yl) acetate (PubChem CID 58636069) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is (4'-acetyloxy-7,7'-dimethyl-3,3'-spirobi[1,2-dihydroindene]-4-yl) acetate.
| Compound Name | (4'-acetyloxy-7,7'-dimethyl-3,3'-spirobi[1,2-dihydroindene]-4-yl) acetate |
|---|---|
| PubChem CID | 58636069 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (4'-acetyloxy-7,7'-dimethyl-3,3'-spirobi[1,2-dihydroindene]-4-yl) acetate |
| SMILES | CC(=O)Oc1ccc(C)c2c1C1(CC2)CCc2c(C)ccc(OC(C)=O)c21 |
| InChI | InChI=1S/C23H24O4/c1-13-5-7-19(26-15(3)24)21-17(13)9-11-23(21)12-10-18-14(2)6-8-20(22(18)23)27-16(4)25/h5-8H,9-12H2,1-4H3 |
| InChIKey | WXBFWUHTKUDOBF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|